CAS 1864003-36-0

Ethanone, 1-(2S)-2-piperidinyl-, hydrochloride (1:1)

Description:

Ethanone, 1-(2S)-2-piperidinyl-, hydrochloride (1:1), also known by its CAS number 1864003-36-0, is a chemical compound characterized by its piperidine moiety, which contributes to its potential biological activity. This substance is a hydrochloride salt, indicating that it is a protonated form of the base compound, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. The presence of the ethanone functional group suggests that it may participate in reactions typical of ketones, such as nucleophilic addition. The stereochemistry indicated by the (2S) designation implies that the compound has a specific three-dimensional arrangement, which can significantly influence its interaction with biological targets, such as receptors or enzymes. As a hydrochloride salt, it is likely to exhibit improved stability and bioavailability compared to its free base form. Overall, this compound may be of interest in medicinal chemistry and pharmacology, particularly for its potential therapeutic effects.

Formula: C₇H₁₃NO·ClH

InChI: InChI=1S/C7H13NO.ClH/c1-6(9)7-4-2-3-5-8-7;/h7-8H,2-5H2,1H3;1H/t7-;/m0./s1

InChI key: InChIKey=GIEAHXNYUNRUDM-FJXQXJEOSA-N

SMILES: C(C)(=O)[C@@H]1CCCCN1.Cl

Synonyms:

• Ethanone, 1-(2S)-2-piperidinyl-, hydrochloride (1:1)
• 1-[(2S)-Piperidin-2-yl]ethan-1-one hydrochloride

1-[(2S)-Piperidin-2-yl]ethan-1-one hydrochloride

CAS: 1864003-36-0

Versatile small molecule scaffold

Formula: C₇H₁₄ClNO

Purity: Min. 95%

Molecular weight: 163.64 g/mol

Ref: 3D-PZC00336