CAS 1864013-95-5

Benzeneacetic acid, 2-bromo-5-methoxy-α-(methylamino)-, hydrochloride (1:1)

Description:

Benzeneacetic acid, 2-bromo-5-methoxy-α-(methylamino)-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with a bromo group, a methoxy group, and a methylamino group, along with a carboxylic acid functional group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. The presence of the bromo and methoxy substituents can affect the compound's reactivity and biological activity, potentially making it of interest in medicinal chemistry. The methylamino group suggests potential interactions with biological targets, possibly influencing neurotransmitter systems. As a hydrochloride salt, it is likely to be more stable and easier to handle in laboratory settings. Overall, this compound may exhibit unique chemical properties and biological activities, making it a subject of interest for further research, particularly in the fields of organic synthesis and pharmacology.

Formula: C₁₀H₁₂BrNO₃·ClH

InChI: InChI=1S/C10H12BrNO3.ClH/c1-12-9(10(13)14)7-5-6(15-2)3-4-8(7)11;/h3-5,9,12H,1-2H3,(H,13,14);1H

InChI key: InChIKey=AVYMLRFERHCLLT-UHFFFAOYSA-N

SMILES: C(C(O)=O)(NC)C1=CC(OC)=CC=C1Br.Cl

Synonyms:

• Benzeneacetic acid, 2-bromo-5-methoxy-α-(methylamino)-, hydrochloride (1:1)

2-(2-Bromo-5-methoxyphenyl)-2-(methylamino)acetic acid hydrochloride

CAS: 1864013-95-5

Versatile small molecule scaffold

Formula: C₁₀H₁₃BrClNO₃

Purity: Min. 95%

Molecular weight: 310.57 g/mol

Ref: 3D-PZC01395