CAS 1864015-10-0

2-Pyrimidinemethanamine, 4-amino-α-methyl-, hydrochloride (1:2)

Description:

2-Pyrimidinemethanamine, 4-amino-α-methyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. This substance features an amino group and a methyl group attached to the pyrimidine, contributing to its basicity and potential reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry for potential therapeutic uses. Its molecular structure allows for interactions with biological targets, which can be explored in drug development. Safety and handling precautions should be observed, as with any chemical, due to potential toxicity or reactivity. Overall, this compound represents a class of nitrogen-containing heterocycles that are significant in both synthetic and medicinal chemistry.

Formula: C₆H₁₀N₄·2ClH

InChI: InChI=1S/C6H10N4.2ClH/c1-4(7)6-9-3-2-5(8)10-6;;/h2-4H,7H2,1H3,(H2,8,9,10);2*1H

InChI key: InChIKey=NMOIIOSBRZSCJN-UHFFFAOYSA-N

SMILES: C(C)(N)C=1N=C(N)C=CN1.Cl

Synonyms:

• 2-Pyrimidinemethanamine, 4-amino-α-methyl-, hydrochloride (1:2)

2-(1-Aminoethyl)pyrimidin-4-amine dihydrochloride

CAS: 1864015-10-0

Versatile small molecule scaffold

Formula: C₆H₁₂Cl₂N₄

Purity: Min. 95%

Molecular weight: 211.09 g/mol

Ref: 3D-PZC01510