CAS 1864015-66-6

Piperidine, 4-[[(4-bromophenyl)sulfonyl]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[[(4-bromophenyl)sulfonyl]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a sulfonyl group attached to a bromophenyl moiety, indicating the presence of a sulfonamide functional group that enhances its reactivity and solubility in polar solvents. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure suggests potential applications in drug development, particularly in the synthesis of pharmaceuticals targeting various biological pathways. The presence of the bromine atom may also influence its electronic properties and reactivity, making it a valuable intermediate in organic synthesis. Safety and handling precautions should be observed due to the potential toxicity associated with brominated compounds and sulfonamides.

Formula: C₁₂H₁₆BrNO₂S·ClH

InChI: InChI=1S/C12H16BrNO2S.ClH/c13-11-1-3-12(4-2-11)17(15,16)9-10-5-7-14-8-6-10;/h1-4,10,14H,5-9H2;1H

InChI key: InChIKey=MVYQNFIQPVLFLN-UHFFFAOYSA-N

SMILES: S(CC1CCNCC1)(=O)(=O)C2=CC=C(Br)C=C2.Cl

Synonyms:

• Piperidine, 4-[[(4-bromophenyl)sulfonyl]methyl]-, hydrochloride (1:1)

4-[(4-Bromobenzenesulfonyl)methyl]piperidine hydrochloride

CAS: 1864015-66-6

Versatile small molecule scaffold

Formula: C₁₂H₁₇BrClNO₂S

Purity: Min. 95%

Molecular weight: 354.69 g/mol

Ref: 3D-PZC01566