CAS 1864016-67-0

Piperidine, 4-(cyclohexylsulfonyl)-, hydrochloride (1:1)

Description:

Piperidine, 4-(cyclohexylsulfonyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of a cyclohexylsulfonyl group indicates that a cyclohexyl group is attached to a sulfonyl moiety, contributing to the compound's unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Overall, Piperidine, 4-(cyclohexylsulfonyl)-, hydrochloride is a specialized compound with specific applications in research and development.

Formula: C₁₁H₂₁NO₂S·ClH

InChI: InChI=1S/C11H21NO2S.ClH/c13-15(14,10-4-2-1-3-5-10)11-6-8-12-9-7-11;/h10-12H,1-9H2;1H

InChI key: InChIKey=FWQWENLVJRLMHL-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1CCCCC1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-(cyclohexylsulfonyl)-, hydrochloride (1:1)

4-(Cyclohexanesulfonyl)piperidine hydrochloride

CAS: 1864016-67-0

Versatile small molecule scaffold

Formula: C₁₁H₂₂ClNO₂S

Purity: Min. 95%

Molecular weight: 267.82 g/mol

Ref: 3D-PZC01667