
CAS 1864052-02-7: 2,4-Imidazolidinedione, 3-(4-piperidinyl)-, hydrochloride (1:1)
Description:2,4-Imidazolidinedione, 3-(4-piperidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its imidazolidinedione core structure, which features a five-membered ring containing two nitrogen atoms and two carbonyl groups. The presence of a piperidine moiety enhances its pharmacological properties, potentially contributing to its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, particularly in pharmaceutical formulations. This compound may exhibit properties such as being a potential therapeutic agent, with implications in areas like neuropharmacology or other medicinal chemistry fields. Its specific interactions, stability, and reactivity can be influenced by the piperidine substituent and the imidazolidinedione framework. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory or industrial settings. Further studies would be necessary to fully elucidate its mechanism of action and potential applications in drug development.
Formula:C8H13N3O2·ClH
InChI:InChI=1S/C8H13N3O2.ClH/c12-7-5-10-8(13)11(7)6-1-3-9-4-2-6;/h6,9H,1-5H2,(H,10,13);1H
InChI key:InChIKey=VHSHEGSVHJVBFI-UHFFFAOYSA-N
SMILES:Cl.O=C1NCC(=O)N1C2CCNCC2
- Synonyms:
- 2,4-Imidazolidinedione, 3-(4-piperidinyl)-, hydrochloride (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-(piperidin-4-yl)imidazolidine-2,4-dione hydrochloride REF: 10-F512048CAS: 1864052-02-7 | 95.0% | To inquire | Thu 15 May 25 |
![]() | 3-(Piperidin-4-yl)imidazolidine-2,4-dione hydrochloride REF: 3D-PZC05202CAS: 1864052-02-7 | Min. 95% | - - - | Discontinued product |

3-(piperidin-4-yl)imidazolidine-2,4-dione hydrochloride
Ref: 10-F512048
250mg | To inquire | ||
500mg | To inquire |

3-(Piperidin-4-yl)imidazolidine-2,4-dione hydrochloride
Ref: 3D-PZC05202
10mg | Discontinued | Request information | |
100mg | Discontinued | Request information |