CymitQuimica logo

CAS 1864057-90-8

:

1-(Phenylmethyl) 5-fluoro-1,3-piperidinedicarboxylate

Description:
1-(Phenylmethyl) 5-fluoro-1,3-piperidinedicarboxylate, identified by its CAS number 1864057-90-8, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, substituted with a phenylmethyl group and two carboxylate ester functionalities. The presence of a fluorine atom at the 5-position of the piperidine ring contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The ester groups in the molecule may enhance its solubility and stability, making it of interest in medicinal chemistry and drug development. Additionally, the compound's structure suggests potential applications in various fields, including pharmaceuticals, where modifications to piperidine derivatives are often explored for therapeutic effects. As with many chemical substances, safety and handling precautions should be observed, as the specific biological effects and toxicity profiles would need to be evaluated through empirical studies.
Formula:C14H16FNO4
InChI:InChI=1S/C14H16FNO4/c15-12-6-11(13(17)18)7-16(8-12)14(19)20-9-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H,17,18)
InChI key:InChIKey=QGRPPKXRMWZVMA-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC(C(O)=O)CC(F)C2
Synonyms:
  • 1,3-Piperidinedicarboxylic acid, 5-fluoro-, 1-(phenylmethyl) ester
  • 1-(Phenylmethyl) 5-fluoro-1,3-piperidinedicarboxylate
Found 2 products.