CAS 1864058-20-7

3,4-Dihydro-6-methoxy-2-naphthalenesulfonyl chloride

Description:

3,4-Dihydro-6-methoxy-2-naphthalenesulfonyl chloride is a chemical compound characterized by its naphthalene structure, which features a sulfonyl chloride functional group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. The presence of the methoxy group contributes to its reactivity and solubility in organic solvents. As a sulfonyl chloride, it is known for its ability to act as a sulfonating agent, making it useful in various synthetic applications, particularly in the preparation of sulfonamides and other derivatives. The compound is sensitive to moisture and should be handled with care, as it can release hydrochloric acid upon hydrolysis. Its reactivity also makes it a valuable intermediate in organic synthesis, particularly in the pharmaceutical and agrochemical industries. Safety precautions should be observed when working with this compound due to its potential irritant properties and the need for proper storage conditions to maintain its stability.

Formula: C₁₁H₁₁ClO₃S

InChI: InChI=1S/C11H11ClO3S/c1-15-10-4-2-9-7-11(16(12,13)14)5-3-8(9)6-10/h2,4,6-7H,3,5H2,1H3

InChI key: InChIKey=PBVIDHLUQCDCFF-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=CC=2C(=CC(OC)=CC2)CC1

Synonyms:

• 2-Naphthalenesulfonyl chloride, 3,4-dihydro-6-methoxy-
• 3,4-Dihydro-6-methoxy-2-naphthalenesulfonyl chloride

6-Methoxy-3,4-dihydronaphthalene-2-sulfonyl chloride

CAS: 1864058-20-7

Versatile small molecule scaffold

Formula: C₁₁H₁₁ClO₃S

Purity: Min. 95%

Molecular weight: 258.72 g/mol

Ref: 3D-PZC05820