CAS 1864073-10-8

Benzeneethanamine, 2-(4-morpholinyl)-, hydrochloride (1:2)

Description:

Benzeneethanamine, 2-(4-morpholinyl)-, hydrochloride (1:2), also known by its CAS number 1864073-10-8, is a chemical compound characterized by its amine and morpholine functional groups. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The morpholine ring contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various neurological and psychiatric conditions. The compound's structure suggests it may exhibit properties such as being a potential neurotransmitter modulator or having other therapeutic effects. As with many amines, it may also exhibit basicity, allowing it to interact with acids to form salts. Safety and handling precautions are essential, as with any chemical, to mitigate risks associated with exposure or reactivity.

Formula: C₁₂H₁₈N₂O·2ClH

InChI: InChI=1S/C12H18N2O.2ClH/c13-6-5-11-3-1-2-4-12(11)14-7-9-15-10-8-14;;/h1-4H,5-10,13H2;2*1H

InChI key: InChIKey=KFESXNHNZYBFIT-UHFFFAOYSA-N

SMILES: C(CN)C1=C(C=CC=C1)N2CCOCC2.Cl

Synonyms:

• Benzeneethanamine, 2-(4-morpholinyl)-, hydrochloride (1:2)

2-[2-(Morpholin-4-yl)phenyl]ethan-1-amine dihydrochloride

CAS: 1864073-10-8

Versatile small molecule scaffold

Formula: C₁₂H₂₀Cl₂N₂O

Purity: Min. 95%

Molecular weight: 279.2 g/mol

Ref: 3D-PZC07310