CAS 186413-75-2

3-Bromo-6-chloro-2-methyl-5-nitropyridine

Description:

3-Bromo-6-chloro-2-methyl-5-nitropyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features multiple substituents: a bromine atom at the 3-position, a chlorine atom at the 6-position, a methyl group at the 2-position, and a nitro group at the 5-position. These functional groups contribute to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of both halogens (bromine and chlorine) and a nitro group suggests that the compound may exhibit interesting electronic properties and reactivity patterns, making it a candidate for further study in synthetic chemistry. Additionally, the methyl group can influence the compound's solubility and stability. As with many nitro-substituted compounds, it may also exhibit specific biological activities, warranting investigation for potential medicinal uses. Safety and handling precautions should be observed due to the presence of halogens and nitro groups, which can pose hazards in laboratory settings.

Formula: C₆H₄BrClN₂O₂

InChI: InChI=1S/C6H4BrClN2O2/c1-3-4(7)2-5(10(11)12)6(8)9-3/h2H,1H3

InChI key: InChIKey=PVECCSKVOZZRPC-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(Cl)N=C(C)C(Br)=C1

Synonyms:

• 3-Bromo-6-chloro-2-methyl-5-nitropyridine
• Pyridine, 3-Bromo-6-Chloro-2-Methyl-5-Nitro-

3-Bromo-6-chloro-2-methyl-5-nitropyridine

CAS: 186413-75-2

Formula: C₆H₄BrClN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 251.4652

Ref: IN-DA003J3H

5-Bromo-2-chloro-6-methyl-3-nitropyridine

CAS: 186413-75-2

5-Bromo-2-chloro-6-methyl-3-nitropyridine

Purity: 98%

Molecular weight: 251.47g/mol

Ref: 54-OR345286

3-Bromo-6-chloro-2-methyl-5-nitropyridine

CAS: 186413-75-2

Formula: C₆H₄BrClN₂O₂

Purity: 98%

Color and Shape: Solid, Yellow powder

Molecular weight: 251.46

Ref: 10-F049686