CymitQuimica logo

CAS 18642-23-4

:

Psoralidin

Description:
Psoralidin is a naturally occurring compound classified as a furanocoumarin, primarily derived from plants in the Apiaceae family, such as Psoralea corylifolia. It is known for its potential therapeutic properties, including anti-inflammatory, antioxidant, and antimicrobial effects. Psoralidin exhibits a complex structure characterized by a fused furan and coumarin moiety, contributing to its biological activity. The compound has garnered interest in the field of medicinal chemistry for its potential applications in treating various conditions, including skin disorders and certain types of cancer. Additionally, psoralidin has been studied for its role in enhancing the efficacy of certain drugs and its potential to modulate various signaling pathways within cells. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in pharmaceutical formulations. Overall, psoralidin represents a significant area of research due to its diverse biological activities and potential health benefits.
Formula:C20H16O5
InChI:InChI=1S/C20H16O5/c1-10(2)3-4-11-7-14-17(9-15(11)22)25-20(23)18-13-6-5-12(21)8-16(13)24-19(14)18/h3,5-9,21-22H,4H2,1-2H3
InChI key:InChIKey=YABIJLLNNFURIJ-UHFFFAOYSA-N
SMILES:O=C1C2=C(C=3C(O1)=CC(O)=C(CC=C(C)C)C3)OC=4C2=CC=C(O)C4
Synonyms:
  • 3,9-Dihydroxy-2-(3-methyl-2-buten-1-yl)-6H-benzofuro[3,2-c][1]benzopyran-6-one
  • 3,9-Dihydroxy-2-(3-methyl-2-butenyl)-6H-benzofuro(3,2-c)(1)benzopyran-6-one
  • 3,9-Dihydroxy-2-(3-methylbut-2-enyl)-[1]benzofuro[3,2-c]chromen-6-one
  • 3,9-dihydroxy-2-(3-methylbut-2-en-1-yl)-6H-[1]benzofuro[3,2-c]chromen-6-one
  • 3-Benzofurancarboxylic acid, 2-[2,4-dihydroxy-5-(3-methyl-2-butenyl)phenyl]-6-hydroxy-, δ-lactone
  • 6H-Benzofuro(3,2-c)(1)benzopyran-6-one, 3,9-dihydroxy-2-(3-methyl-2-butenyl)-
  • 6H-Benzofuro[3,2-c][1]benzopyran-6-one, 3,9-dihydroxy-2-(3-methyl-2-buten-1-yl)-
  • Psoralidin
Found 11 products.