CAS 186446-27-5

6-Chloro-4-fluoro-1H-indole-2-carboxylic acid

Description:

6-Chloro-4-fluoro-1H-indole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a carboxylic acid functional group (-COOH) at the 2-position contributes to its acidic properties, while the chlorine and fluorine substituents at the 6 and 4 positions, respectively, enhance its reactivity and influence its biological activity. This compound is often utilized in medicinal chemistry and research due to its potential pharmacological properties. It may exhibit various biological activities, including antimicrobial or anti-inflammatory effects, making it of interest in drug development. The molecular structure allows for interactions with biological targets, and its halogen substituents can affect lipophilicity and solubility, which are critical for bioavailability. As with many indole derivatives, it may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile building block in organic synthesis.

Formula: C₉H₅ClFNO₂

InChI: InChI=1S/C9H5ClFNO2/c10-4-1-6(11)5-3-8(9(13)14)12-7(5)2-4/h1-3,12H,(H,13,14)

InChI key: InChIKey=WXQBCNRBBDRVJD-UHFFFAOYSA-N

SMILES: FC1=C2C(NC(C(O)=O)=C2)=CC(Cl)=C1

Synonyms:

• 1H-Indole-2-carboxylic acid, 6-chloro-4-fluoro-
• 6-Chloro-4-fluoro-1H-indole-2-carboxylic acid

6-Chloro-4-fluoro-1H-indole-2-carboxylic acid

CAS: 186446-27-5

Versatile small molecule scaffold

Formula: C₉H₅ClFNO₂

Purity: Min. 95%

Molecular weight: 213.59 g/mol

Ref: 3D-LHA44627