CAS 18649-93-9: Alisol B
Description:Alisol B, with the CAS number 18649-93-9, is a naturally occurring triterpenoid compound primarily derived from the rhizomes of the plant Alisma orientale, commonly known as water plantain. This compound is characterized by its complex tetracyclic structure, which contributes to its biological activity. Alisol B exhibits various pharmacological properties, including anti-inflammatory, hepatoprotective, and diuretic effects, making it of interest in traditional medicine and potential therapeutic applications. The substance is typically found in the form of a white to off-white powder and is soluble in organic solvents like methanol and ethanol, but less soluble in water. Its mechanism of action and efficacy in various biological systems are subjects of ongoing research, highlighting its potential as a lead compound in drug development. Additionally, Alisol B's safety profile and toxicity are important considerations for its use in medicinal formulations. Overall, Alisol B represents a significant compound in the field of natural products chemistry and pharmacology.
Formula:C30H48O4
InChI:InChI=1S/C30H48O4/c1-17(15-21(32)25-27(4,5)34-25)18-9-13-29(7)19(18)16-20(31)24-28(6)12-11-23(33)26(2,3)22(28)10-14-30(24,29)8/h17,20-22,24-25,31-32H,9-16H2,1-8H3/t17-,20+,21+,22+,24+,25-,28+,29+,30+/m1/s1
InChI key:InChIKey=GBJKHDVRXAVITG-UNPOXIGHSA-N
SMILES:O=C1CCC2(C)C(CCC3(C)C2C(O)CC4=C(CCC43C)C(C)CC(O)C5OC5(C)C)C1(C)C
- Synonyms:
- (23S,24R)-24,25-Epoxy-11b,23-dihydroxy-8a,9b,14b-dammar-13(17)-en-3-one
- (5Xi,8Alpha,9Beta,11Beta,14Beta)-11,23-Dihydroxy-24,25-Epoxydammar-13(17)-En-3-One
- (8α,9β,11β,14β,23S,24R)-24,25-Epoxy-11,23-dihydroxydammar-13(17)-en-3-one
- 16-Deoxoalisol C
- 8α,9β,14β-Dammar-13(17)-en-3-one, 24,25-epoxy-11β,23-dihydroxy-, (23S,24R)-
- Dammar-13(17)-en-3-one, 24,25-epoxy-11,23-dihydroxy-, (8α,9β,11β,14β,23S,24R)-
- Alisol B
