CAS 18649-93-9

Alisol B

Description:

Alisol B, with the CAS number 18649-93-9, is a naturally occurring triterpenoid compound primarily derived from the rhizomes of the plant Alisma orientale, commonly known as water plantain. This compound is characterized by its complex tetracyclic structure, which contributes to its biological activity. Alisol B exhibits various pharmacological properties, including anti-inflammatory, hepatoprotective, and diuretic effects, making it of interest in traditional medicine and potential therapeutic applications. The substance is typically found in the form of a white to off-white powder and is soluble in organic solvents like methanol and ethanol, but less soluble in water. Its mechanism of action and efficacy in various biological systems are subjects of ongoing research, highlighting its potential as a lead compound in drug development. Additionally, Alisol B's safety profile and toxicity are important considerations for its use in medicinal formulations. Overall, Alisol B represents a significant compound in the field of natural products chemistry and pharmacology.

Formula: C₃₀H₄₈O₄

InChI: InChI=1S/C30H48O4/c1-17(15-21(32)25-27(4,5)34-25)18-9-13-29(7)19(18)16-20(31)24-28(6)12-11-23(33)26(2,3)22(28)10-14-30(24,29)8/h17,20-22,24-25,31-32H,9-16H2,1-8H3/t17-,20+,21+,22+,24+,25-,28+,29+,30+/m1/s1

InChI key: InChIKey=GBJKHDVRXAVITG-UNPOXIGHSA-N

SMILES: C[C@@]12[C@]([C@]3(C)[C@@](CC1)(C(C)(C)C(=O)CC3)[H])([C@@H](O)CC=4[C@]2(C)CCC4[C@@H](C[C@H](O)[C@@]5([C@](C)(C)O5)[H])C)[H]

Synonyms:

• (23S,24R)-24,25-Epoxy-11b,23-dihydroxy-8a,9b,14b-dammar-13(17)-en-3-one
• (5Xi,8Alpha,9Beta,11Beta,14Beta)-11,23-Dihydroxy-24,25-Epoxydammar-13(17)-En-3-One
• (8α,9β,11β,14β,23S,24R)-24,25-Epoxy-11,23-dihydroxydammar-13(17)-en-3-one
• 16-Deoxoalisol C
• 8α,9β,14β-Dammar-13(17)-en-3-one, 24,25-epoxy-11β,23-dihydroxy-, (23S,24R)-
• Dammar-13(17)-en-3-one, 24,25-epoxy-11,23-dihydroxy-, (8α,9β,11β,14β,23S,24R)-
• Alisol B

Dammar-13(17)-en-3-one, 24,25-epoxy-11,23-dihydroxy-,(8a,9b,11b,14b,23S,24R)-

CAS: 18649-93-9

Formula: C₃₀H₄₈O₄

Purity: 98%

Molecular weight: 472.6997

Ref: IN-DA00I1TI

Alisol B

CAS: 18649-93-9

Formula: C₃₀H₄₈O₄

Molecular weight: 472.71

Ref: 7W-GY2327

Alisol B

CAS: 18649-93-9

Alisol B

Purity: ≥95%

Molecular weight: 472.7g/mol

Ref: 54-BUP04582

Alisol B

CAS: 18649-93-9

Alisol B, a novel inhibitor of the sarcoplasmic/endoplasmic reticulum Ca(2+) ATPase pump, induces autophagy, endoplasmic reticulum stress, and apoptosis.Alisol B may be a potential novel therapeutic molecule for bone disorders through targeting the differentiation of osteoclasts as well as their functions. Alisol B also inhibited RANKL-induced expression of NFATc1 and c-Fos, which are key transcription factors for osteoclastogenesis.

Formula: C₃₀H₄₈O₄

Purity: 95%~99%

Color and Shape: Cryst.

Molecular weight: 472.71

Ref: BP-BP3059

Alisol B

CAS: 18649-93-9

Alisol B may be a potential novel therapeutic molecule for bone disorders through targeting the differentiation of osteoclasts as well as their functions.

Formula: C₃₀H₄₈O₄

Purity: 99.22% - 99.77%

Color and Shape: Solid

Molecular weight: 472.70

Ref: TM-T5770

Alisol b

CAS: 18649-93-9

Ketone alcohol

Formula: C₃₀H₄₈O₄

Purity: ≥ 90.0 % (HPLC)

Molecular weight: 472.7

Ref: 5G-84199

Alisol B

Controlled Product

CAS: 18649-93-9

Alisol B is a natural compound that has been shown to be cytotoxic and synergistic with other drugs. It is believed to inhibit the activation of the toll-like receptor 2, which is involved in the immune response. Alisol B also inhibits the activation of mitochondrial functions, including mitochondrial respiration and ATP production. This inhibition may be due to the presence of reactive oxygen species (ROS). Alisol B has been shown to induce autophagy, a process by which cells degrade their own components through lysosomes. The chemiluminescence method was used to measure the anticancer effects of alisol B on human breast cancer cells.

Formula: C₃₀H₄₈O₄

Purity: Min. 95%

Molecular weight: 472.7 g/mol

Ref: 3D-FA44561