CAS 186495-99-8
:N-[3,3-Bis(3-fluorophenyl)propyl]-N-methylamine hydrochloride
Description:
N-[3,3-Bis(3-fluorophenyl)propyl]-N-methylamine hydrochloride is a chemical compound characterized by its unique structure, which includes a propyl chain substituted with two 3-fluorophenyl groups and a methylamine moiety. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in research and pharmaceuticals. The presence of fluorine atoms in the phenyl rings can influence the compound's electronic properties and biological activity, potentially enhancing its potency or selectivity in pharmacological contexts. The compound's molecular structure suggests it may interact with biological targets, making it of interest in medicinal chemistry. Additionally, its hydrochloride form indicates that it can be handled more easily in laboratory settings, as salts often exhibit improved stability and handling characteristics compared to their free base counterparts. As with any chemical substance, proper safety protocols should be followed when handling this compound, including the use of personal protective equipment and adherence to relevant regulations.
Formula:C16H18ClF2N
InChI:InChI=1/C16H17F2N.ClH/c1-19-9-8-16(12-4-2-6-14(17)10-12)13-5-3-7-15(18)11-13;/h2-7,10-11,16,19H,8-9H2,1H3;1H
Synonyms:- Delucemine hydrochloride
- Nps-1506
- 3,3-bis(3-fluorophenyl)-N-methylpropan-1-amine hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Delucemine Hydrochloride
CAS:Controlled ProductFormula:C16H17F2N·ClHColor and Shape:NeatMolecular weight:297.771Delucemine Hydrochloride
CAS:<p>Delucemine Hydrochloride (Delucemine) is a polyamine NMDA receptor antagonist used in the study of neurological disorders such as depression.</p>Formula:C16H18ClF2NPurity:98.49% - 99.30%Color and Shape:SolidMolecular weight:297.77
