CAS 1865-29-8
:2-PHENYL-ACRYLIC ACID METHYL ESTER
Description:
2-Phenyl-acrylic acid methyl ester, with the CAS number 1865-29-8, is an organic compound that belongs to the class of esters. It is characterized by its structure, which features a phenyl group attached to an acrylic acid moiety, with a methyl ester functional group. This compound typically appears as a colorless to pale yellow liquid and has a pleasant, aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water. The compound is known for its applications in organic synthesis, particularly in the production of various pharmaceuticals and agrochemicals. Additionally, it may exhibit properties such as UV absorption, making it useful in formulations requiring light stability. Safety data indicates that it should be handled with care, as it may cause irritation to the skin and eyes. Overall, 2-phenyl-acrylic acid methyl ester is a versatile compound with significant relevance in chemical research and industrial applications.
Formula:C10H10O2
InChI:InChI=1/C10H10O2/c1-8(10(11)12-2)9-6-4-3-5-7-9/h3-7H,1H2,2H3
InChI key:GQTXKEVAUZYHGE-UHFFFAOYSA-N
SMILES:C=C(c1ccccc1)C(=O)OC
Synonyms:- Methyl Atropate
- Methyl 2-Phenylprop-2-Enoate
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Methyl 2-Phenylacrylate (stabilized with TBC)
CAS:Formula:C10H10O2Purity:>95.0%(GC)Molecular weight:162.19Methyl 2-phenylacrylate
CAS:Methyl 2-phenylacrylateFormula:C10H10O2Purity:95%Molecular weight:162.18519Methyl 2-phenylacrylate
CAS:Formula:C10H10O2Purity:95%Color and Shape:LiquidMolecular weight:162.1852Methyl 2-phenylacrylate
CAS:Methyl 2-phenylacrylateFormula:C10H10O2Purity:95% (stabilized with TBC)Molecular weight:162.19Methyl 2-phenylacrylate
CAS:Purity:95% (stabilized with TBC)Color and Shape:LiquidMolecular weight:162.19Methyl 2-phenylacrylate
CAS:Methyl 2-phenylacrylate is a synthetic chemical that is used in the production of polymers. It reacts with oxygen to give an oxidative carbonylation product, which consists of a particle and a functional group. The particle can be made insoluble by polymerisation. The reaction mechanism involves the donation of a methyl cinnamate group to the carbonyl group, which has a redox potential and kinetic energy that are sufficient for the reaction to proceed. Methyl 2-phenylacrylate has been used as an initiator for free radical polymerisation, which leads to cross-linked polymers. This initiator also reacts with other functional groups such as phenol or amine groups.
Formula:C10H10O2Purity:Min. 95%Molecular weight:162.19 g/mol





