CymitQuimica logo

CAS 186517-43-1

:

2,3-difluoro-6-(trifluoromethyl)benzaldehyde

Description:
2,3-Difluoro-6-(trifluoromethyl)benzaldehyde is an aromatic aldehyde characterized by the presence of both fluorine substituents and an aldehyde functional group. This compound features a benzene ring with two fluorine atoms located at the 2 and 3 positions, and a trifluoromethyl group (-CF3) at the 6 position, which significantly influences its chemical properties. The presence of multiple fluorine atoms enhances the compound's lipophilicity and stability, making it less reactive than its non-fluorinated counterparts. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in synthesis and as an intermediate in the production of more complex molecules. Additionally, its unique electronic properties, stemming from the electronegative fluorine atoms, can affect its reactivity and interactions with biological systems. Safety precautions should be taken when handling this compound, as with many fluorinated organic substances.
Formula:C8H3F5O
InChI:InChI=1/C8H3F5O/c9-6-2-1-5(8(11,12)13)4(3-14)7(6)10/h1-3H
SMILES:c1cc(c(c(C=O)c1C(F)(F)F)F)F
Synonyms:
  • 2,3-Difluor-6-(trifluormethyl)benzolcarbaldehyd
  • Benzaldehyde, 2,3-Difluoro-6-(Trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.