CAS 186517-45-3
:2-Chloro-3-fluoro-6-(trifluoromethyl)benzoyl chloride
Description:
2-Chloro-3-fluoro-6-(trifluoromethyl)benzoyl chloride is an organic compound characterized by its aromatic structure, which includes a benzoyl chloride functional group. This compound features a chlorine atom and a fluorine atom positioned on the benzene ring, along with a trifluoromethyl group (-CF3) that significantly influences its chemical properties. The presence of these halogen substituents enhances the compound's reactivity, making it useful in various synthetic applications, particularly in the field of pharmaceuticals and agrochemicals. The trifluoromethyl group is known for imparting lipophilicity and metabolic stability, which can be advantageous in drug design. Additionally, the compound is likely to be a solid at room temperature and may exhibit moderate to high toxicity, necessitating careful handling and storage. Its reactivity as an acyl chloride suggests it can readily participate in nucleophilic acyl substitution reactions, making it a valuable intermediate in organic synthesis. As with many halogenated compounds, it may also pose environmental and health risks, warranting appropriate safety measures during use.
Formula:C8H2Cl2F4O
InChI:InChI=1S/C8H2Cl2F4O/c9-6-4(11)2-1-3(8(12,13)14)5(6)7(10)15/h1-2H
InChI key:InChIKey=QXSLFEJMHHTJAH-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=C(C(F)(F)F)C=CC(F)=C1Cl
Synonyms:- 2-Chloro-3-fluoro-6-(trifluoromethyl)benzoyl chloride
- Benzoyl chloride, 2-chloro-3-fluoro-6-(trifluoromethyl)-
- 2,3-Dichloro-6-trifluoromethylbenzoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
3-Chloro-2-fluoro-6-(trifluoromethyl)benzoyl chloride
CAS:Formula:C8H2Cl2F4OMolecular weight:261.00053-Chloro-2-fluoro-6-(trifluoromethyl)benzoyl chloride
CAS:3-Chloro-2-fluoro-6-(trifluoromethyl)benzoyl chlorideFormula:C8H2Cl2F4OPurity:techColor and Shape: colourless liquidMolecular weight:261.00049g/mol3-Chloro-2-fluoro-6-(trifluoromethyl)benzoylchloride
CAS:Formula:C8H2Cl2F4OColor and Shape:LiquidMolecular weight:261


