CAS 186584-73-6

2-Fluoro-5-iodobenzoyl chloride

Description:

2-Fluoro-5-iodobenzoyl chloride is an organic compound characterized by the presence of both a fluorine and an iodine atom on a benzene ring, along with a carbonyl chloride functional group. Its molecular structure features a benzoyl chloride moiety, which is a common functional group in organic synthesis, known for its reactivity in acylation reactions. The presence of the fluorine atom can enhance the compound's electrophilicity, while the iodine atom may influence its reactivity and stability. This compound is typically used in the synthesis of various pharmaceuticals and agrochemicals, owing to its ability to participate in nucleophilic substitution reactions. It is important to handle this substance with care, as it can be corrosive and may pose health risks if inhaled or ingested. Additionally, it is advisable to store it in a cool, dry place, away from moisture and incompatible substances. As with many halogenated compounds, it may also have specific environmental considerations regarding its degradation and persistence.

Formula: C₇H₃ClFIO

InChI: InChI=1/C7H3ClFIO/c8-7(11)5-3-4(10)1-2-6(5)9/h1-3H

SMILES: c1cc(c(cc1I)C(=O)Cl)F

2-Fluoro-5-iodobenzoyl chloride

CAS: 186584-73-6

Formula: C₇H₃ClFIO

Purity: 97%

Color and Shape: Solid

Molecular weight: 284.4540

Ref: IN-DA003HA8

2-Fluoro-5-iodobenzoyl chloride

CAS: 186584-73-6

2-Fluoro-5-iodobenzoyl chloride

Formula: C₇H₃ClFIO

Purity: By gc: 99.8% by area (Typical Value in Batch COA)

Color and Shape: white crystalline solid

Molecular weight: 284.45g/mol

Ref: 54-PC2165

2-Fluoro-5-iodobenzoyl chloride

CAS: 186584-73-6

Formula: C₇H₃ClFIO

Purity: 97%;RG

Molecular weight: 284.45

Ref: 10-F013055