CymitQuimica logo

CAS 186589-89-9

:

2-fluoro-5-iodo-phenol

Description:
2-Fluoro-5-iodo-phenol is an organic compound characterized by the presence of both fluorine and iodine substituents on a phenolic ring. The molecular structure features a hydroxyl group (-OH) attached to a benzene ring, which is further substituted at the 2-position with a fluorine atom and at the 5-position with an iodine atom. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents and varying melting and boiling points depending on the specific conditions. The presence of halogens (fluorine and iodine) can influence its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit unique spectroscopic properties, allowing for its identification and characterization through techniques such as NMR and IR spectroscopy. Safety precautions should be taken when handling this compound, as halogenated phenols can be hazardous.
Formula:C6H4FIO
InChI:InChI=1/C6H4FIO/c7-5-2-1-4(8)3-6(5)9/h1-3,9H
InChI key:JDGBFLDXIZQLLT-UHFFFAOYSA-N
SMILES:c1cc(c(cc1I)O)F
Synonyms:
  • 2-Fluoro-5-iodophenol
  • Phenol, 2-Fluoro-5-Iodo-
Found 4 products.