CAS 186593-43-1

5-Amino-3-Bromo-2-methylpyridin

Description:

5-Amino-3-bromo-2-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with an amino group, a bromo group, and a methyl group. The presence of the amino group (-NH2) imparts basic properties to the molecule, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. The bromo group (-Br) serves as a versatile leaving group, facilitating further functionalization of the compound. The methyl group (-CH3) contributes to the overall hydrophobic character of the molecule, influencing its solubility and reactivity. This compound is typically used in organic synthesis and medicinal chemistry, where it may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique structure allows for potential applications in developing new materials or biologically active compounds. As with many brominated compounds, care should be taken regarding its handling and disposal due to potential environmental and health impacts.

Formula: C₆H₇BrN₂

InChI: InChI=1/C6H7BrN2/c1-4-6(7)2-5(8)3-9-4/h2-3H,8H2,1H3

SMILES: Cc1c(cc(cn1)N)Br

Synonyms:

• 3-Bromo-5-Amino-2-Picoline
• 5-Bromo-6-methylpyridin-3-amine

5-Amino-3-bromo-2-methylpyridine

CAS: 186593-43-1

Formula: C₆H₇BrN₂

Purity: >98.0%(GC)(T)

Color and Shape: White to Brown powder to crystal

Molecular weight: 187.04

Ref: 3B-A2996

5-Amino-3-bromo-2-methylpyridine

CAS: 186593-43-1

Formula: C₆H₇BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 187.0372

Ref: IN-DA00APJF

5-Amino-3-bromo-2-methylpyridine

CAS: 186593-43-1

5-Amino-3-bromo-2-methylpyridine

Formula: C₆H₇BrN₂

Purity: 98%

Color and Shape: faint orange to brown crystlaline solid

Molecular weight: 187.04g/mol

Ref: 54-OR315100

5-Bromo-6-methylpyridin-3-amine

CAS: 186593-43-1

Formula: C₆H₇BrN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 187.04

Ref: 10-F064785