CAS 186600-27-1
:(2S,3R)-3-[(2S,3S,4R,5R,6S)-3-acetamido-6-[[(2R,3S,4R,5S,6S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxymethyl]-5-hydroxy-4-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]oxy-2-ami
Description:
The chemical substance with the name "(2S,3R)-3-[(2S,3S,4R,5R,6S)-3-acetamido-6-[[(2R,3S,4R,5S,6S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxymethyl]-5-hydroxy-4-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]oxy-2-ami" and CAS number "186600-27-1" is a complex organic compound characterized by multiple stereocenters and a polycyclic structure. It features a series of hydroxyl and acetamido functional groups, which contribute to its solubility and reactivity. The presence of tetrahydropyran rings indicates that it may exhibit significant biological activity, potentially interacting with various biological pathways. This compound is likely to be a derivative of a carbohydrate or a related structure, suggesting potential applications in medicinal chemistry or as a biochemical agent. Its intricate stereochemistry may influence its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion. Overall, the compound's structural complexity and functional groups suggest it could play a role in therapeutic applications, although specific biological activities would require further investigation.
Formula:C26H45N3O18
InChI:InChI=1/C26H45N3O18/c1-7(13(27)23(40)41)43-25-15(29-9(3)33)22(47-26-21(39)20(38)17(35)11(5-31)45-26)18(36)12(46-25)6-42-24-14(28-8(2)32)19(37)16(34)10(4-30)44-24/h7,10-22,24-26,30-31,34-39H,4-6,27H2,1-3H3,(H,28,32)(H,29,33)(H,40,41)/t7-,10+,11+,12+,13+,14+,15+,16-,17+,18+,19-,20+,21+,22-,24-,25+,26+/m1/s1
Synonyms:- GALΒ(1-3)[GLCNACΒ(1-6)]GALNAC-Α-THR
- L-Threonine, O-[O-2-(acetylamino)-2-deoxy-β-D-glucopyranosyl-(1→6)-O-[β-D-galactopyranosyl-(1→3)]-2-(acetylamino)-2-deoxy-α-D-galactopyranosyl]-
- Gal beta(1-3)[GlcNAc beta(1-6)]GalNAc-alpha-Thr
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Galβ(1-3)[GlcNAcβ(1-6)]GalNAc-α-Thr
CAS:Formula:C26H45N3O18Color and Shape:White to Almost white powder to crystalMolecular weight:687.65
