CAS 186611-56-3

5-Chloro-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylene]-1,3-dihydroindol-2-one

Description:

5-Chloro-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylene]-1,3-dihydroindol-2-one is a synthetic organic compound characterized by its complex structure, which includes an indole core and a pyrrole moiety. The presence of a chlorine atom at the 5-position of the indole ring contributes to its reactivity and potential biological activity. This compound features a methylene bridge connecting the pyrrole and indole components, which may influence its conformational properties and interactions with biological targets. It is often studied for its potential pharmacological applications, particularly in the fields of medicinal chemistry and drug development. The compound's unique structural features may impart specific properties, such as solubility, stability, and binding affinity to various receptors or enzymes. As with many synthetic compounds, its safety profile, including toxicity and environmental impact, would need to be assessed through appropriate studies. Overall, 5-Chloro-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylene]-1,3-dihydroindol-2-one represents a class of compounds that may hold promise for therapeutic applications.

Formula: C₁₅H₁₃ClN₂O

InChI: InChI=1S/C15H13ClN2O/c1-8-5-9(2)17-14(8)7-12-11-6-10(16)3-4-13(11)18-15(12)19/h3-7,17H,1-2H3,(H,18,19)

InChI key: InChIKey=XLBQNZICMYZIQT-UHFFFAOYSA-N

SMILES: C(=C1C=2C(NC1=O)=CC=C(Cl)C2)C3=C(C)C=C(C)N3

Synonyms:

• SU 5614
• 5-Chloro-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylene]-1,3-dihydroindol-2-one
• 2H-Indol-2-one, 5-chloro-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylene]-1,3-dihydro-
• 5-Chloro-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylene]-1,3-dihydro-2H-indol-2-one