CymitQuimica logo

CAS 18664-26-1

:

1,3-dicyclohexyl-1-nitrosourea

Description:
1,3-Dicyclohexyl-1-nitrosourea, with the CAS number 18664-26-1, is a chemical compound that belongs to the class of nitrosoureas, which are known for their alkylating properties. This substance typically appears as a solid and is characterized by its ability to form covalent bonds with nucleophilic sites in biological molecules, particularly DNA. The presence of the nitrosourea functional group contributes to its reactivity, making it a potent agent in various chemical and biological applications, including cancer research and drug development. Its structure features two cyclohexyl groups attached to a central urea moiety, which influences its solubility and stability. 1,3-Dicyclohexyl-1-nitrosourea is also noted for its potential toxicity, necessitating careful handling and usage in laboratory settings. As with many nitrosoureas, it may exhibit mutagenic and carcinogenic properties, underscoring the importance of safety protocols when working with this compound. Overall, its unique chemical characteristics make it a valuable compound in medicinal chemistry and pharmacology.
Formula:C13H23N3O2
InChI:InChI=1/C13H23N3O2/c17-13(14-11-7-3-1-4-8-11)16(15-18)12-9-5-2-6-10-12/h11-12H,1-10H2,(H,14,17)
Synonyms:
  • urea, N,N'-dicyclohexyl-N-nitroso-
  • 1,3-Dicyclohexyl-1-nitrosourea
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.