CAS 18664-39-6
:3-(4-Cyanophenyl)-2-propenoic acid
Description:
3-(4-Cyanophenyl)-2-propenoic acid, also known as a derivative of cinnamic acid, is an organic compound characterized by its propenoic acid structure with a cyanophenyl substituent. This compound features a vinyl group (–CH=CH2) attached to a carboxylic acid (–COOH) and a phenyl ring that is further substituted with a cyano group (–CN) at the para position. The presence of the cyano group enhances its reactivity and polar character, making it useful in various chemical applications, including as an intermediate in organic synthesis and in the development of pharmaceuticals. The compound is typically a solid at room temperature and may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. Its unique structure allows for potential applications in materials science, particularly in the synthesis of polymers and dyes. Additionally, the compound's reactivity can be exploited in various chemical reactions, including Michael additions and other nucleophilic substitutions.
Formula:C10H7NO2
InChI:InChI=1S/C10H7NO2/c11-7-9-3-1-8(2-4-9)5-6-10(12)13/h1-6H,(H,12,13)
InChI key:InChIKey=USVZQKYCNGNRBV-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=CC=C(C#N)C=C1
Synonyms:- (2E)-3-(4-cyanophenyl)prop-2-enoate
- 2-Propenoic acid, 3-(4-cyanophenyl)-
- 3-(4-Cyanophenyl)-2-propenoic acid
- 3-(4-Cyanophenyl)Prop-2-Enoic Acid
- 4-Cyanocinnamic acid
- Cinnamic acid, p-cyano-
- NSC 134574
- p-Cyanocinnamic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Cyanocinnamic acid
CAS:4-Cyanocinnamic acid is a fatty acid that has been shown to be a substrate for the bacterial enzyme cinnamate 4-hydroxylase. The molecular weight of this compound is 136.16 g/mol, and it has a constant boiling point of 206°C. It can be synthesized from phenylacetic acid and p-coumaric acid using a transesterification reaction. This compound is reactive with carbonyl groups, which makes it useful in the detection of gram-positive bacteria by fluorescent probes or fluorescent dyes. 4-Cyanocinnamic acid is unreactive with esters of carboxylic acids, such as methyl esters, making it useful for the determination of fatty acids in isolates.
Formula:C10H7NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:173.17 g/mol


