CAS 186692-46-6: Roscovitine
Description:Roscovitine, also known as Seliciclib, is a selective inhibitor of cyclin-dependent kinases (CDKs), particularly CDK2, CDK7, and CDK9, which play crucial roles in cell cycle regulation and transcription. Its chemical formula is C15H16N4O, and it features a purine-like structure that allows it to interfere with the phosphorylation processes essential for cell division and gene expression. Roscovitine has been investigated primarily for its potential therapeutic applications in cancer treatment, as it can induce cell cycle arrest and apoptosis in various cancer cell lines. Additionally, it has shown promise in treating other conditions, such as neurodegenerative diseases, due to its ability to modulate cellular pathways. The compound is typically administered in a pharmaceutical formulation and has undergone various clinical trials to assess its efficacy and safety profile. Its mechanism of action and specificity make it a valuable tool in both research and potential therapeutic contexts, although further studies are necessary to fully understand its effects and optimize its use in clinical settings.
Formula:C19H26N6O
InChI:InChI=1S/C19H26N6O/c1-4-15(11-26)22-19-23-17(20-10-14-8-6-5-7-9-14)16-18(24-19)25(12-21-16)13(2)3/h5-9,12-13,15,26H,4,10-11H2,1-3H3,(H2,20,22,23,24)/t15-/m1/s1
InChI key:InChIKey=BTIHMVBBUGXLCJ-OAHLLOKOSA-N
SMILES:OCC(NC=1N=C(NCC=2C=CC=CC2)C=3N=CN(C3N1)C(C)C)CC
- Synonyms:
- (2R)-2-[[6-(Benzylamino)-9-propan-2-ylpurin-2-yl]amino]butan-1-ol
- (2R)-2-[[9-(1-Methylethyl)-6-[(phenylmethyl)amino]-9H-purin-2-yl]amino]-1-butanol
- (2R)-2-{[6-(benzylamino)-9-(propan-2-yl)-9H-purin-2-yl]amino}butan-1-ol
- (R)-Roscovitine
- 1-Butanol, 2-((9-(1-methylethyl)-6-((phenylmethyl)amino)-9H-purin-2-yl)amino)-, (2R)-
- 1-Butanol, 2-((9-(1-methylethyl)-6-((phenylmethyl)amino)-9H-purin-2-yl)amino)-, (R)-
- 2-(R)-(1-Ethyl-2-hydroxyethylamino)-6-benzylamino-9-isopropylpurine
- Cyc 202
- Cyc202
- Nsc 701554
- See more synonyms
- Roscovitin
- Seliciclib
- Unii-0Es1C2Kq94
- Roscovitine
