CAS 18672-76-9

1-Amino-4-(1,1-dimethylethyl)cyclohexanecarboxylic acid

Description:

1-Amino-4-(1,1-dimethylethyl)cyclohexanecarboxylic acid, commonly referred to as a derivative of cyclohexanecarboxylic acid, is an organic compound characterized by the presence of an amino group and a carboxylic acid functional group. This compound features a cyclohexane ring substituted with a tert-butyl group (1,1-dimethylethyl) at the 4-position and an amino group at the 1-position. Its molecular structure contributes to its potential as a chiral building block in organic synthesis and pharmaceutical applications. The presence of both the amino and carboxylic acid groups allows for various interactions, including hydrogen bonding, which can influence its solubility and reactivity. Typically, compounds like this exhibit moderate polarity, making them soluble in polar solvents. Additionally, the tert-butyl group provides steric hindrance, which can affect the compound's reactivity and interactions with other molecules. Overall, this compound's unique structure and functional groups make it of interest in medicinal chemistry and synthetic organic chemistry.

Formula: C₁₁H₂₁NO₂

InChI: InChI=1S/C11H21NO2/c1-10(2,3)8-4-6-11(12,7-5-8)9(13)14/h8H,4-7,12H2,1-3H3,(H,13,14)

InChI key: InChIKey=PDNQBLZMZSRSKK-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(N)CCC(C(C)(C)C)CC1

Synonyms:

• Cyclohexanecarboxylic acid, 1-amino-4-(1,1-dimethylethyl)-
• 1-Amino-4-tert-butylcyclohexane-1-carboxylic acid
• 1-Amino-4-(tert-butyl)cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 1-amino-4-tert-butyl-
• 1-Amino-4-(1,1-dimethylethyl)cyclohexanecarboxylic acid