CAS 18673-13-7
:Methyl 3-(ethylthio)propanoate
Description:
Methyl 3-(ethylthio)propanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of propanoic acid and methanol, with an ethylthio substituent. It typically appears as a colorless to pale yellow liquid with a fruity odor, making it potentially useful in flavor and fragrance applications. The presence of the ethylthio group imparts unique chemical properties, including increased reactivity and potential for various chemical transformations. This compound is soluble in organic solvents and exhibits moderate volatility. Its molecular structure contributes to its role in synthetic organic chemistry, particularly in the synthesis of more complex molecules. Additionally, Methyl 3-(ethylthio)propanoate may have applications in the pharmaceutical industry, although specific biological activities would require further investigation. As with many organic compounds, safety precautions should be observed when handling this substance, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.
Formula:C6H12O2S
InChI:InChI=1S/C6H12O2S/c1-3-9-5-4-6(7)8-2/h3-5H2,1-2H3
InChI key:InChIKey=HKZAEFYOTHDMNN-UHFFFAOYSA-N
SMILES:C(CCSCC)(OC)=O
Synonyms:- 3-Ethylsulfanyl-Propionic Acid Methyl Ester
- 3-Ethylsulfanylpropionic acid methyl ester
- Methyl 3-(ethylsulfanyl)propanoate
- Methyl 3-(ethylthio)propanoate
- Methyl 3-(ethylthio)propionate
- NSC 46447
- Propanoic acid, 3- (ethylthio)-, methyl ester
- Propionic acid, 3- (ethylthio)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.