CAS 18678-14-3
:2-Phenylthieno[3,2-d]pyrimidin-4(3H)-one
Description:
2-Phenylthieno[3,2-d]pyrimidin-4(3H)-one is a heterocyclic compound characterized by its fused thieno and pyrimidine rings, which contribute to its unique chemical properties. This compound features a phenyl group attached to the thieno moiety, enhancing its aromatic character and potentially influencing its reactivity and solubility. The presence of a carbonyl group at the 4-position of the pyrimidine ring is significant, as it can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. The structure of 2-Phenylthieno[3,2-d]pyrimidin-4(3H)-one suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, its unique structural features may impart specific biological activities, making it a subject of interest in drug discovery and development. The compound is typically characterized by methods such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its structure and purity.
Formula:C12H8N2OS
InChI:InChI=1S/C12H8N2OS/c15-12-10-9(6-7-16-10)13-11(14-12)8-4-2-1-3-5-8/h1-7H,(H,13,14,15)
InChI key:InChIKey=IQFQFNJSTCCSSP-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(=N1)C3=CC=CC=C3)C=CS2
Synonyms:- 2-Phenyl-1H-thieno[3,2-d]pyrimidin-4-one
- 2-Phenylthieno[3,2-d]pyrimidin-4(3H)-one
- Thieno[3,2-d]pyrimidin-4-ol, 2-phenyl-
- Thieno[3,2-d]pyrimidin-4(3H)-one, 2-phenyl-
- Thieno[3,2-d]pyrimidin-4(1H)-one, 2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
