CAS 1868-58-2

2-FLUORO-3-BROMO-5-NITRO PYRIDINE

Description:

2-Fluoro-3-bromo-5-nitropyridine is a heterocyclic aromatic compound characterized by the presence of a pyridine ring substituted with three distinct functional groups: a fluorine atom at the 2-position, a bromine atom at the 3-position, and a nitro group at the 5-position. This compound is typically a yellow to brown solid at room temperature and is known for its moderate solubility in organic solvents such as ethanol and acetone. The presence of the electronegative halogens (fluorine and bromine) and the nitro group contributes to its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The compound's molecular structure allows for potential applications in medicinal chemistry, where the unique electronic properties of the substituents can influence biological activity. Safety precautions should be observed when handling this compound, as it may pose health risks due to its halogenated and nitro functionalities.

Formula: C₅H₂BrFN₂O₂

InChI: InChI=1/C5H2BrFN2O2/c6-4-1-3(9(10)11)2-8-5(4)7/h1-2H

SMILES: c1c(cnc(c1Br)F)N(=O)=O

Synonyms:

• 3-Bromo-2-fluoro-5-nitropyridine
• 2-Fluoro-5-Bromo-3-Nitropyridine

3-Bromo-2-fluoro-5-nitropyridine, 97%

CAS: 1868-58-2

3-Bromo-2-fluoro-5-nitropyridine is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU

Formula: C₅H₂BrFN₂O₂

Purity: 97%

Molecular weight: 220.99

Ref: 02-H61500

3-Bromo-2-fluoro-5-nitropyridine

CAS: 1868-58-2

Formula: C₅H₂BrFN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 220.9840

Ref: IN-DA00754O

3-Bromo-2-fluoro-5-nitropyridine

CAS: 1868-58-2

Formula: C₅H₂BrFN₂O₂

Molecular weight: 220.98

Ref: 7W-GK1682

3-Bromo-2-fluoro-5-nitropyridine

CAS: 1868-58-2

3-Bromo-2-fluoro-5-nitropyridine

Purity: 97%

Molecular weight: 220.98g/mol

Ref: 54-PC445025

3-Bromo-2-fluoro-5-nitropyridine

CAS: 1868-58-2

Formula: C₅H₂BrFN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 220.985

Ref: 10-F211104