CAS 1868-80-0
:2,3,4,5-Tetrafluoro-6-Chlorobenzoic Acid
Description:
2,3,4,5-Tetrafluoro-6-chlorobenzoic acid is a halogenated aromatic carboxylic acid characterized by the presence of four fluorine atoms and one chlorine atom attached to a benzene ring, along with a carboxylic acid functional group (-COOH). This compound is typically a white to off-white solid at room temperature and is known for its high stability due to the strong C-F bonds. The presence of multiple electronegative halogens significantly influences its chemical reactivity, making it a useful intermediate in organic synthesis, particularly in the production of agrochemicals and pharmaceuticals. It exhibits moderate solubility in polar solvents and can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, its unique electronic properties, stemming from the fluorine and chlorine substituents, can affect its acidity and reactivity, making it an interesting subject for studies in medicinal chemistry and materials science. Safety precautions should be taken when handling this compound, as halogenated compounds can pose environmental and health risks.
Formula:C7HClF4O2
InChI:InChI=1/C7HClF4O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h(H,13,14)
SMILES:c1(c(c(c(c(c1F)F)F)F)Cl)C(=O)O
Synonyms:- 2-Chloro-3,4,5,6-Tetrafluorobenzoic Acid
- 6-Chloro-2,3,4,5-tetrafluorobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3,4,5-Tetrafluoro-6-chlorobenzoic acid
CAS:<p>2,3,4,5-Tetrafluoro-6-chlorobenzoic acid</p>Purity:≥95%Molecular weight:228.53g/mol2,3,4,5-Tetrafluoro-6-chlorobenzoic acid
CAS:<p>2,3,4,5-Tetrafluoro-6-chlorobenzoic acid is a useful chemical that can be used as a precursor in the synthesis of many organic compounds. This compound has been shown to be an efficient and reliable reagent for the preparation of high quality 2,3,4,5-tetrafluoro-6-chlorobenzoic acid. It is also an important building block in organic chemistry and has been shown to be versatile enough to react with a wide range of other chemicals. CAS No. 1868-80-0</p>Formula:C7HClF4O2Purity:Min. 95%Color and Shape:PowderMolecular weight:228.53 g/mol



