CAS 18680-27-8: (+)-Pinanediol
Description:(+)-Pinanediol, with the CAS number 18680-27-8, is a bicyclic organic compound that belongs to the class of terpenoids. It is a diol, meaning it contains two hydroxyl (-OH) functional groups, which contribute to its reactivity and solubility in polar solvents. This compound is typically derived from pinene, a common terpene found in pine resin. (+)-Pinanediol is characterized by its chiral nature, existing in a specific enantiomeric form that exhibits optical activity. It is often used in the synthesis of fragrances, flavors, and as a potential intermediate in organic synthesis. The presence of hydroxyl groups allows for hydrogen bonding, which influences its physical properties, such as boiling point and solubility. Additionally, (+)-Pinanediol may exhibit biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Its stability and reactivity can be influenced by the surrounding environment, making it a versatile compound in chemical applications.
Formula:C10H18O2
InChI:InChI=1S/C10H18O2/c1-9(2)6-4-7(9)10(3,12)8(11)5-6/h6-8,11-12H,4-5H2,1-3H3/t6-,7-,8+,10-/m0/s1
InChI key:InChIKey=MOILFCKRQFQVFS-OORONAJNSA-N
SMILES:OC1CC2CC(C1(O)C)C2(C)C
- Synonyms:
- (+)-2-Hydroxyisopinocampheol
- (+)-Pinanediol
- (1S,2S,3R,5S)-(+)-Pinane-2,3-diol
- (1S,2S,3R,5S)-2,6,6-Trimethylbicyclo[3.1.1]heptane-2,3-diol
- (1S,2S,5S)-2,6,6-Trimethylbicyclo[3.1.1]heptane-2,3-diol
- (1S,3R,4S,5S)-4,6,6-trimethylbicyclo[3.1.1]heptane-3,4-diol
- 1s,2s,3R,5s(+)Pinanediol
- 2,3-Pinanediol
- 2,3-Pinanediol, (1S,2S,3R,5S)-(+)-
- 2,6,6-Trimethylbicyclo[3.1.1]Heptane-2,3-Diol
- See more synonyms
- 2α,3α-Pinanediol
- Bicyclo[3.1.1]heptane-2,3-diol, 2,6,6-trimethyl-, (1S,2S,3R,5S)-
- Bicyclo[3.1.1]heptane-2,3-diol, 2,6,6-trimethyl-, [1S-(1α,2α,3α,5α)]-
- (1S,2S,3R,5S)-(+)-2,3-Pinanediol