
CAS 186829-19-6
:2-Chloro-3-pyridin-3-yl-5,6,7,8-tetrahydroindolizine-1-carboxamide
Description:
2-Chloro-3-pyridin-3-yl-5,6,7,8-tetrahydroindolizine-1-carboxamide is a chemical compound characterized by its complex structure, which includes a chloro group, a pyridine ring, and a tetrahydroindolizine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its unique molecular configuration. The presence of the chloro substituent may influence its reactivity and interaction with biological targets. As a carboxamide, it may also participate in hydrogen bonding, which can affect its pharmacokinetic properties. The compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, where it may exhibit activity against specific biological pathways or diseases. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be studied for its efficacy and safety in various biological assays. Overall, 2-Chloro-3-pyridin-3-yl-5,6,7,8-tetrahydroindolizine-1-carboxamide represents a class of compounds that could be valuable in therapeutic contexts.
Formula:C14H14ClN3O
InChI:InChI=1S/C14H14ClN3O/c15-12-11(14(16)19)10-5-1-2-7-18(10)13(12)9-4-3-6-17-8-9/h3-4,6,8H,1-2,5,7H2,(H2,16,19)
InChI key:InChIKey=KNGXENHWYNLKBU-UHFFFAOYSA-N
SMILES:ClC1=C(N2C(=C1C(N)=O)CCCC2)C=3C=CC=NC3
Synonyms:- CMV 423
- 1-Indolizinecarboxamide, 2-chloro-5,6,7,8-tetrahydro-3-(3-pyridinyl)-
- 2-Chloro-3-pyridin-3-yl-5,6,7,8-tetrahydroindolizine-1-carboxamide
- RPR 111423
- 2-Chloro-5,6,7,8-tetrahydro-3-(3-pyridinyl)-1-indolizinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
CMV-423
CAS:CMV-423 is an antiviral agent exhibiting effective in vitro activity against beta-herpesviruses, including Human Cytomegalovirus (HCMV), Human Herpesvirus 6 (HHV-6), and Human Herpesvirus 7 (HHV-7). It is utilized in antiviral research.Formula:C14H14ClN3OColor and Shape:SolidMolecular weight:275.73
