
CAS 18684-55-4
:7-Oxodehydroabietic acid
Description:
7-Oxodehydroabietic acid is a chemical compound derived from the natural resin of coniferous trees, specifically from the degradation of abietic acid. It is characterized by its molecular structure, which includes a ketone functional group at the 7-position of the dehydroabietic acid framework. This compound typically exhibits a solid state at room temperature and is known for its potential applications in various fields, including materials science and organic synthesis. Its chemical properties include moderate solubility in organic solvents and limited solubility in water, which is common for many terpenoid derivatives. 7-Oxodehydroabietic acid may also possess biological activities, making it of interest in pharmacological research. The compound's reactivity can be influenced by the presence of functional groups, allowing for further chemical modifications. Overall, 7-Oxodehydroabietic acid serves as an important intermediate in the synthesis of more complex organic molecules and has implications in both industrial and medicinal chemistry.
Formula:C20H26O3
InChI:InChI=1S/C20H26O3/c1-12(2)13-6-7-15-14(10-13)16(21)11-17-19(15,3)8-5-9-20(17,4)18(22)23/h6-7,10,12,17H,5,8-9,11H2,1-4H3,(H,22,23)/t17-,19-,20-/m1/s1
InChI key:InChIKey=MSWJSDLNPCSSNW-MISYRCLQSA-N
SMILES:C[C@@]12[C@]([C@@](C(O)=O)(C)CCC1)(CC(=O)C=3C2=CC=C(C(C)C)C3)[H]
Synonyms:- 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-9-oxo-, [1R-(1α,4aβ,10aα)]-
- Podocarpa-8,11,13-trien-15-oic acid, 13-isopropyl-7-oxo-
- (1R,4aS,10aR)-1,2,3,4,4a,9,10,10a-Octahydro-1,4a-dimethyl-7-(1-methylethyl)-9-oxo-1-phenanthrenecarboxylic acid
- 1-Phenanthrenecarboxylic acid, 1,2,3,4,4a,9,10,10a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-9-oxo-, (1R,4aS,10aR)-
- 7-Ketodehydroabietic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(1R,4aS,10aR)-1,4a-dimethyl-9-oxo-7-(propan-2-yl)-1,2,3,4,4a,9,10,10a-octahydrophenanthrene-1-carboxylic acid
CAS:Formula:C20H26O3Purity:95%Color and Shape:SolidMolecular weight:314.41867-Oxodehydroabietic acid
CAS:<p>7-Oxodehydroabietic acid, a diterpene in Pinus densiflora roots, defends against insects by hindering their endocrine system.</p>Formula:C20H26O3Color and Shape:SolidMolecular weight:314.427-Oxodehydroabietic acid
CAS:<p>7-Oxodehydroabietic acid is a diterpenoid derivative, which is a naturally occurring compound extracted primarily from the resin of coniferous trees. This compound belongs to the abietane diterpenoid class, characterized by its unique structural composition derived from oxidative processes in plant resins. The mode of action of 7-Oxodehydroabietic acid involves interference with various biological pathways, including enzymatic reactions and signal transduction mechanisms that are crucial for cellular processes.</p>Formula:C20H26O3Purity:Min. 95%Color and Shape:PowderMolecular weight:314.4 g/mol


