CAS 18685-19-3
:Methyl 2,3,4-tris-O-(phenylmethyl)-6-O-(triphenylmethyl)-α-D-glucopyranoside
Description:
Methyl 2,3,4-tris-O-(phenylmethyl)-6-O-(triphenylmethyl)-α-D-glucopyranoside is a complex glycoside derived from glucose, characterized by multiple phenylmethyl and triphenylmethyl protective groups. This compound features a glucopyranoside structure, which is a six-membered cyclic form of glucose, indicating its role in carbohydrate chemistry. The presence of the phenylmethyl groups suggests that it may exhibit hydrophobic properties, potentially influencing its solubility and reactivity in organic solvents. The triphenylmethyl group serves as a robust protecting group, commonly used in organic synthesis to shield hydroxyl functionalities during chemical reactions. This compound is likely to be of interest in synthetic organic chemistry, particularly in the development of glycosylation reactions or as a precursor in the synthesis of more complex carbohydrate derivatives. Its structural complexity may also impart unique biological activities, making it a candidate for further investigation in medicinal chemistry. Overall, this substance exemplifies the intricate interplay between carbohydrate chemistry and organic synthesis methodologies.
Formula:C47H46O6
InChI:InChI=1S/C47H46O6/c1-48-46-45(51-34-38-24-12-4-13-25-38)44(50-33-37-22-10-3-11-23-37)43(49-32-36-20-8-2-9-21-36)42(53-46)35-52-47(39-26-14-5-15-27-39,40-28-16-6-17-29-40)41-30-18-7-19-31-41/h2-31,42-46H,32-35H2,1H3/t42-,43-,44+,45-,46+/m1/s1
InChI key:InChIKey=AYWIUINDNNLVIG-PSKPMRIASA-N
SMILES:C(OC[C@@H]1[C@@H](OCC2=CC=CC=C2)[C@H](OCC3=CC=CC=C3)[C@@H](OCC4=CC=CC=C4)[C@@H](OC)O1)(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7
Synonyms:- Methyl 2,3,4-tris-O-(phenylmethyl)-6-O-(triphenylmethyl)-α-D-glucopyranoside
- α-D-Glucopyranoside, methyl 2,3,4-tris-O-(phenylmethyl)-6-O-(triphenylmethyl)-
- Glucopyranoside, methyl 2,3,4-tri-O-benzyl-6-O-trityl-, α-D-
- Methyl 2,3,4-tri-O-benzyl-6-O-trityl-α-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 2,3,4-tri-O-benzyl-6-O-trityl-a-D-glucopyranoside
CAS:Methyl 2,3,4-tri-O-benzyl-6-O-trityl-a-D-glucopyranoside is a modification of the sugar molecule. This modification process is completed by reacting the sugar with a derivative of benzyl alcohol. The result is an increase in the number of functional groups on the sugar molecule and a change in its physical properties. Methyl 2,3,4-tri-O-benzyl-6-O-trityl-a -D glucopyranoside has been used in the synthesis of oligosaccharides and polysaccharides. Methyl 2,3,4 -tri -O -benzyl -6 -O -trityl--a D glucopyranoside is an organic compound that belongs to the class of carbohydrates. It is a white powder that contains water solubility and has a melting point of about 145°C. MethylFormula:C47H46O6Purity:Min. 95%Molecular weight:706.89 g/mol

