CymitQuimica logo

CAS 186958-84-9

:

4-Chloro-1-methyl-1H-1,2,3-triazolo[4,5-c]pyridine

Description:
4-Chloro-1-methyl-1H-1,2,3-triazolo[4,5-c]pyridine is a heterocyclic compound characterized by its unique triazole and pyridine ring structures. This compound features a chlorine atom at the 4-position and a methyl group at the 1-position of the triazole ring, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and exhibits moderate solubility in polar organic solvents. The presence of the triazole moiety often imparts interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Additionally, the compound may exhibit antimicrobial or antifungal properties, although specific biological activities would depend on further empirical studies. As with many halogenated compounds, safety precautions should be taken during handling due to potential toxicity.
Formula:C6H5ClN4
InChI:InChI=1S/C6H5ClN4/c1-11-4-2-3-8-6(7)5(4)9-10-11/h2-3H,1H3
InChI key:InChIKey=USOZWBFLRCFYDC-UHFFFAOYSA-N
SMILES:ClC1=C2C(N(C)N=N2)=CC=N1
Synonyms:
  • 1H-1,2,3-Triazolo[4,5-c]pyridine, 4-chloro-1-methyl-
  • 4-Chloro-1-methyl-1H-1,2,3-triazolo[4,5-c]pyridine
  • NSC 264038
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.