CAS 187-96-2
:tribenzo[de,h,kl]naphtho[1,2,3,4-rst]pentaphene
Description:
Tribenzo[de,h,kl]naphtho[1,2,3,4-rst]pentaphene, with CAS number 187-96-2, is a polycyclic aromatic hydrocarbon (PAH) characterized by its complex fused ring structure, which consists of multiple benzene rings. This compound exhibits high stability due to its extensive conjugated π-electron system, contributing to its unique optical and electronic properties. It is typically insoluble in water but may dissolve in organic solvents, reflecting its hydrophobic nature. The compound is known for its potential applications in organic electronics, such as organic light-emitting diodes (OLEDs) and organic photovoltaics, due to its ability to facilitate charge transport. Additionally, like many PAHs, it may pose environmental and health risks, as some derivatives are known to be carcinogenic. Its synthesis often involves multi-step organic reactions, and its characterization can be performed using techniques such as nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry. Overall, tribenzo[de,h,kl]naphtho[1,2,3,4-rst]pentaphene is a significant compound in the study of advanced materials and organic chemistry.
Formula:C38H20
InChI:InChI=1/C38H20/c1-2-14-24-23(13-1)33-27-17-5-9-21-10-7-19-29(31(21)27)35-25-15-3-4-16-26(25)36-30-20-8-12-22-11-6-18-28(32(22)30)34(24)38(36)37(33)35/h1-20H
SMILES:c1ccc2c(c1)c1c3cccc4cccc(c34)c3c4ccccc4c4c5cccc6cccc(c56)c2c4c13
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
