CAS 187030-12-2

[(1-methyl-1H-indol-3-yl)sulfanyl]acetic acid

Description:

[(1-methyl-1H-indol-3-yl)sulfanyl]acetic acid, with the CAS number 187030-12-2, is a chemical compound that features a unique structure combining an indole moiety with a sulfanyl group and an acetic acid functional group. The indole ring contributes to its aromatic properties, which can influence its reactivity and interactions with biological systems. The presence of the sulfanyl (-S-) group suggests potential for nucleophilic reactivity, while the acetic acid portion provides acidic characteristics, allowing for proton donation in appropriate conditions. This compound may exhibit biological activity, potentially interacting with various biological targets, which makes it of interest in medicinal chemistry and pharmacology. Its solubility, stability, and reactivity can be influenced by the functional groups present, and it may participate in various chemical reactions, including esterification and substitution reactions. Overall, the compound's unique structure and functional groups suggest a range of potential applications in research and development within the fields of organic chemistry and drug discovery.

Formula: C₁₁H₁₁NO₂S

InChI: InChI=1/C11H11NO2S/c1-12-6-10(15-7-11(13)14)8-4-2-3-5-9(8)12/h2-6H,7H2,1H3,(H,13,14)

SMILES: Cn1cc(c2ccccc12)SCC(=O)O

Synonyms:

• acetic acid, 2-[(1-methyl-1H-indol-3-yl)thio]-

[(1-methyl-1H-indol-3-yl)thio]acetic acid

CAS: 187030-12-2

Formula: C₁₁H₁₁NO₂S

Purity: 95.0%

Molecular weight: 221.27

Ref: 10-F315201