CAS 18704-37-5
:8-quinolinesulfonyl chloride
Description:
8-Quinolinesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group attached to a quinoline ring system. It typically appears as a yellow to brown solid or liquid, depending on its purity and form. This compound is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. It is often used as a reagent in organic synthesis, particularly for the introduction of sulfonyl groups into various substrates. Additionally, 8-quinolinesulfonyl chloride can serve as a building block in the synthesis of pharmaceuticals and agrochemicals. The compound is sensitive to moisture and should be handled with care, as it can release hydrochloric acid upon hydrolysis. Proper safety precautions, including the use of personal protective equipment, are essential when working with this substance due to its potential irritant properties. Overall, 8-quinolinesulfonyl chloride is a valuable tool in synthetic organic chemistry, facilitating the development of more complex molecular architectures.
Formula:C7H11BrN2
InChI:InChI=1/C7H11BrN2/c1-7(2,3)6-5(8)4-9-10-6/h4H,1-3H3,(H,9,10)
InChI key:InChIKey=JUYUYCIJACTHMK-UHFFFAOYSA-N
SMILES:CC(C)(C)c1c(c[nH]n1)Br
Synonyms:- 2,2,2-Trichloroethyl Phosphorodichloridate
- 4-bromo-3-tert-butyl-1H-pyrazole
- 8-Chinolinsulfonyl chloride
- 8-Chlorosulfonyl-1-benzazine
- 8-Chlorosulfonylquinoline
- 8-Quinolinylsulfonyl chloride
- 8-Quinolylsulfonyl chloride
- NSC 91506
- Quinoline-8-sulfonic acid chloride
- Quinoline-8-sulfonyl choride
- Quinoline-8-sulphonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Quinoline-8-sulfonyl Chloride
CAS:Formula:C9H6ClNO2SPurity:>98.0%(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:227.66Quinoline-8-sulfonyl chloride
CAS:Formula:C9H6ClNO2SPurity:97%Color and Shape:SolidMolecular weight:227.6674Quinoline-8-sulphonyl chloride
CAS:Quinoline-8-sulphonyl chlorideFormula:C9H6ClNO2SPurity:94%Color and Shape: white to off white crystaline solidMolecular weight:227.67g/molQuinoline-8-sulfonyl chloride
CAS:Formula:C9H6ClNO2SPurity:≥ 98.0%Color and Shape:White or off-white crystalline powder or crystalsMolecular weight:227.678-Quinolinesulfonyl chloride
CAS:Formula:C9H6ClNO2SPurity:97%Color and Shape:Solid, CrystallineMolecular weight:227.668-Quinolinesulfonyl chloride
CAS:<p>8-Quinolinesulfonyl chloride (8QSC) is a quinoline derivative that has been shown to have anticancer activity. 8QSC binds to the receptor site of cells and inhibits the production of amines, which are important for cell growth and proliferation. It also binds to hydrogen bonds, which may be involved in the cytotoxicity observed in pancreatic cancer cells. 8QSC shows significant cytotoxicity against Panc-1 cells, but not against NIH 3T3 cells. This may be due to its ability to form supramolecular aggregates with copper ions and quinoline derivatives.</p>Purity:Min. 95%





