CAS 18704-92-2

2-[(phenoxyacetyl)amino]benzoic acid

Description:

2-[(Phenoxyacetyl)amino]benzoic acid, with the CAS number 18704-92-2, is an organic compound characterized by its structure, which includes a benzoic acid moiety substituted with an amino group and a phenoxyacetyl group. This compound typically exhibits properties associated with both acidic and amine functionalities, making it a potential candidate for various chemical reactions and applications. It is likely to be soluble in polar solvents due to the presence of the carboxylic acid group, while the phenoxy group may impart some hydrophobic characteristics. The compound may also exhibit biological activity, potentially serving as a pharmaceutical intermediate or active ingredient, given its structural features that resemble those of known drug molecules. Its synthesis often involves acylation reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₅H₁₃NO₄

InChI: InChI=1/C15H13NO4/c17-14(10-20-11-6-2-1-3-7-11)16-13-9-5-4-8-12(13)15(18)19/h1-9H,10H2,(H,16,17)(H,18,19)

SMILES: c1ccc(cc1)OCC(=Nc1ccccc1C(=O)O)O

Synonyms:

• 2-[(2-Phenoxyacetyl)Amino]Benzoic Acid
• Benzoic Acid, 2-[(2-Phenoxyacetyl)Amino]-

2-(2-Phenoxyacetamido)benzoic acid

CAS: 18704-92-2

Versatile small molecule scaffold

Formula: C₁₅H₁₃NO₄

Purity: Min. 95%

Molecular weight: 271.27 g/mol

Ref: 3D-TAA70492