CAS 18706-33-7

4,6-Dichloro-2-(trifluoromethyl)quinoline

Description:

4,6-Dichloro-2-(trifluoromethyl)quinoline is a synthetic organic compound belonging to the quinoline family, characterized by its fused bicyclic structure containing a nitrogen atom. This compound features two chlorine atoms at the 4 and 6 positions and a trifluoromethyl group at the 2 position, which significantly influences its chemical properties and reactivity. It is typically a solid at room temperature and exhibits low solubility in water, but may dissolve in organic solvents. The presence of halogen substituents enhances its potential for biological activity, making it of interest in medicinal chemistry and agrochemical applications. Its unique structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its behavior in biological systems. Additionally, the trifluoromethyl group is known to increase lipophilicity, potentially impacting the compound's pharmacokinetics. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 4,6-Dichloro-2-(trifluoromethyl)quinoline is a compound of interest for further research in various chemical and biological fields.

Formula: C₁₀H₄Cl₂F₃N

InChI: InChI=1/C10H4Cl2F3N/c11-6-3-1-2-5-7(12)4-8(10(13,14)15)16-9(5)6/h1-4H

SMILES: c1cc2c(cc(C(F)(F)F)nc2c(c1)Cl)Cl

Synonyms:

• 4,8-Dichloro-2-(Trifluoromethyl)Quinoline

4,6-DICHLORO-2-(TRIFLUOROMETHYL)QUINOLINE

CAS: 18706-33-7

Formula: C₁₀H₄Cl₂F₃N

Purity: 95%

Color and Shape: Solid

Molecular weight: 266.0467

Ref: IN-DA007S20

4,6-Dichloro-2-(trifluoromethyl)quinoline

CAS: 18706-33-7

4,6-Dichloro-2-(trifluoromethyl)quinoline

Purity: 98%

Color and Shape: Solid

Molecular weight: 266.04666g/mol

Ref: 54-PC2556W

4,6-Dichloro-2-(trifluoromethyl)quinoline

CAS: 18706-33-7

Formula: C₁₀H₄Cl₂F₃N

Purity: 95%

Color and Shape: Solid

Molecular weight: 266.04

Ref: 10-F321495