CAS 18709-45-0

Methyl 3-phenyl-2H-azirine-2-carboxylate

Description:

Methyl 3-phenyl-2H-azirine-2-carboxylate is a chemical compound characterized by its azirine structure, which features a three-membered nitrogen-containing ring. This compound has a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the phenyl group enhances its aromatic characteristics, which can influence its stability and interaction with other chemical species. Methyl 3-phenyl-2H-azirine-2-carboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, making it useful in various chemical reactions, particularly in the synthesis of more complex organic molecules. The compound may exhibit interesting biological activities, although specific studies would be necessary to elucidate its pharmacological properties. As with many azirine derivatives, it may participate in cycloaddition reactions and other transformations, making it a valuable intermediate in synthetic organic chemistry. Safety precautions should be taken when handling this compound, as with all chemicals, due to potential toxicity and reactivity.

Formula: C₁₀H₉NO₂

InChI: InChI=1S/C10H9NO2/c1-13-10(12)9-8(11-9)7-5-3-2-4-6-7/h2-6,9H,1H3

InChI key: InChIKey=ZFHLVGLOJCNOPP-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1C(=N1)C2=CC=CC=C2

Synonyms:

• 2H-Azirine-2-carboxylic acid, 3-phenyl-, methyl ester
• Methyl 3-phenyl-2H-azirine-2-carboxylate