CAS 1871-72-3
:1-bromo-2-fluoro-propane
Description:
1-Bromo-2-fluoropropane is an organic compound characterized by the presence of both bromine and fluorine substituents on a propane backbone. It is a colorless liquid at room temperature and exhibits a moderate boiling point, typical of halogenated hydrocarbons. The compound is polar due to the electronegativity differences between the bromine and fluorine atoms and the carbon atoms, which can influence its solubility in various solvents. 1-Bromo-2-fluoropropane is used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity is largely dictated by the halogen substituents, making it a potential candidate for nucleophilic substitution reactions. Additionally, the presence of halogens can impart unique properties such as increased density and potential for environmental persistence. Safety considerations are important when handling this compound, as it may pose health risks through inhalation or skin contact, and proper precautions should be taken to mitigate exposure.
Formula:C3H6BrF
InChI:InChI=1/C3H6BrF/c1-3(5)2-4/h3H,2H2,1H3
SMILES:CC(CBr)F
Synonyms:- Propane, 1-bromo-2-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.