CAS 18711-12-1

6,7-dichloro-1H-indole-2,3-dione

Description:

6,7-Dichloro-1H-indole-2,3-dione, with the CAS number 18711-12-1, is a synthetic organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features two chlorine atoms at the 6 and 7 positions of the indole ring, contributing to its reactivity and potential biological activity. The presence of the dione functional groups at the 2 and 3 positions indicates that it contains two carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound is typically used in research settings, particularly in studies related to medicinal chemistry and the development of pharmaceuticals, due to its potential as a bioactive molecule. Its physical properties, such as solubility and melting point, can vary based on the solvent and conditions used. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence.

Formula: C₈H₃Cl₂NO₂

InChI: InChI=1/C8H3Cl2NO2/c9-4-2-1-3-6(5(4)10)11-8(13)7(3)12/h1-2H,(H,11,12,13)

SMILES: c1cc(c(c2c1C(=O)C(=O)N2)Cl)Cl

Synonyms:

• 1H-indole-2,3-dione, 6,7-dichloro-

6,7-dichloro-1H-indole-2,3-dione

CAS: 18711-12-1

Formula: C₈H₃Cl₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 216.0209

Ref: IN-DA00ANEJ

6,7-Dichloro-1H-indole-2,3-dione

CAS: 18711-12-1

6,7-Dichloro-1H-indole-2,3-dione

Purity: 95%

Molecular weight: 216.02g/mol

Ref: 54-OR1002794

6,7-dichloro-1H-indole-2,3-dione

CAS: 18711-12-1

Formula: C₈H₃Cl₂NO₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 216.02

Ref: 10-F313017

6,7-dichloro-2,3-dihydro-1H-indole-2,3-dione

CAS: 18711-12-1

6,7-Dichloro-2,3-dihydro-1H-indole-2,3-dione is a drug that is used to treat high blood pressure. It is a potent inhibitor of the enzyme phosphodiesterase (PDE), which breaks down cyclic adenosine monophosphate (cAMP). 6,7-Dichloro-2,3-dihydro-1H-indole-2,3-dione inhibits PDE and increases the concentration of cAMP in cells. This increase in cAMP leads to an increased effect of the neurotransmitter acetylcholine on the heart and blood vessels. 6,7-Dichloro-2,3-dihydro-1H-indole--2,3--dione also increases calcium binding to membrane receptors and increases membrane hyperpolarization. These changes lead to an increase in nω--nitro--

Formula: C₈H₃Cl₂NO₂

Purity: Min. 95%

Molecular weight: 216.02 g/mol

Ref: 3D-TAA71112