CAS 18711-59-6

4-Methylpyrrole-2-carboxylic acid

Description:

4-Methylpyrrole-2-carboxylic acid, with the CAS number 18711-59-6, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a methyl group at the 4-position and a carboxylic acid functional group at the 2-position of the pyrrole ring, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry and organic synthesis, due to its potential biological activities and utility as a building block in the synthesis of more complex molecules. Its reactivity is influenced by the electron-donating nature of the methyl group and the electron-withdrawing nature of the carboxylic acid, making it a versatile intermediate in chemical reactions. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₆H₇NO₂

InChI: InChI=1/C6H7NO2/c1-4-2-5(6(8)9)7-3-4/h2-3,7H,1H3,(H,8,9)

SMILES: Cc1cc(C(=O)O)[nH]c1

Synonyms:

• 4-Methyl-1H-Pyrrole-2-Carboxylic Acid
• 4-Methyl Pyrrole-2-Carboxylic Acid

4-Methylpyrrole-2-carboxylic acid

CAS: 18711-59-6

Formula: C₆H₇NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 125.1253

Ref: IN-DA0037NE

4-Methyl pyrrole-2-carboxylic acid

CAS: 18711-59-6

4-Methyl pyrrole-2-carboxylic acid

Purity: 98%

Molecular weight: 125.13g/mol

Ref: 54-OR345040

4-Methyl pyrrole-2-carboxylic acid

CAS: 18711-59-6

Formula: C₆H₇NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 125.127

Ref: 10-F040049