CAS 18720-30-4

1-Norbornanecarboxylicacid

Description:

1-Norbornanecarboxylic acid, with the CAS number 18720-30-4, is a bicyclic organic compound characterized by its carboxylic acid functional group attached to a norbornane structure. This compound features a rigid, bridged bicyclic framework, which contributes to its unique chemical properties. It is typically a colorless to pale yellow solid at room temperature and is known for its relatively high melting point compared to many other carboxylic acids. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, 1-norbornanecarboxylic acid can engage in hydrogen bonding, influencing its solubility in polar solvents. Its structural rigidity and functional group make it a valuable intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Overall, this compound exemplifies the interplay between structure and reactivity in organic chemistry, making it of interest for both academic research and industrial applications.

Formula: C₈H₁₂O₂

InChI: InChI=1/C8H12O2/c9-7(10)8-3-1-6(5-8)2-4-8/h6H,1-5H2,(H,9,10)

SMILES: C1CC2(CCC1C2)C(=O)O

Synonyms:

• Bicyclo(2.2.1)heptane-1-carboxylic acid

1-Norbornanecarboxylicacid

CAS: 18720-30-4

Formula: C₈H₁₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 140.1797

Ref: IN-DA00ALZN

Bicyclo[2.2.1]heptane-1-carboxylic acid

CAS: 18720-30-4

Bicyclo[2.2.1]heptane-1-carboxylic acid

Formula: C₈H₁₂O₂

Purity: ≥95%

Color and Shape: grey solid

Molecular weight: 140.18g/mol

Ref: 54-OR22825

BICYCLO[2.2.1]HEPTANE-1-CARBOXYLIC ACID

CAS: 18720-30-4

Purity: 98%

Molecular weight: 140.1820068

Ref: 10-F843088