CAS 1872433-73-2
:Phosphonic acid, P-3,6,9,12-tetraoxatridec-1-yl-, diethyl ester
Description:
Phosphonic acid, P-3,6,9,12-tetraoxatridec-1-yl-, diethyl ester is a chemical compound characterized by its phosphonic acid functional group, which is known for its strong acidity and ability to form stable complexes with metal ions. This compound features a diethyl ester moiety, indicating the presence of two ethyl groups attached to the phosphonic acid, which can influence its solubility and reactivity. The presence of multiple ether linkages in the structure contributes to its potential as a surfactant or emulsifying agent. Additionally, the specific arrangement of the tetraoxatridecyl chain suggests that it may exhibit unique properties related to its molecular size and shape, potentially impacting its biological activity and interactions in various environments. Overall, this compound may find applications in fields such as agriculture, pharmaceuticals, or materials science, where phosphonic acids are often utilized for their ability to enhance the efficacy of active ingredients or modify surface properties.
Formula:C13H29O7P
InChI:InChI=1S/C13H29O7P/c1-4-19-21(14,20-5-2)13-12-18-11-10-17-9-8-16-7-6-15-3/h4-13H2,1-3H3
InChI key:InChIKey=IJIFYTYZSWFMQQ-UHFFFAOYSA-N
SMILES:P(CCOCCOCCOCCOC)(OCC)(OCC)=O
Synonyms:- Phosphonic acid, P-3,6,9,12-tetraoxatridec-1-yl-, diethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
m-PEG4-phosphonic acid ethyl ester
CAS:m-PEG4-phosphonic acid ethyl esterPurity:98%Molecular weight:328.34g/molm-PEG4-phosphonic acid ethyl ester
CAS:m-PEG4-phosphonic acid ethyl ester is a linker for PROTACs, aiding in targeted protein degradation.Formula:C13H29O7PPurity:98%Color and Shape:SolidMolecular weight:328.34M-PEG4-phosphonic acid ethyl ester
CAS:M-PEG4-phosphonic acid ethyl ester is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. M-PEG4-phosphonic acid ethyl ester is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.Formula:C13H29O7PPurity:Min. 95%Molecular weight:328.34 g/mol




