CAS 187269-42-7

2′-Methoxy[1,1′-biphenyl]-3-acetic acid

Description:

2′-Methoxy[1,1′-biphenyl]-3-acetic acid, identified by its CAS number 187269-42-7, is an organic compound characterized by its biphenyl structure with a methoxy group and an acetic acid moiety. This compound features a methoxy group (-OCH₃) attached to one of the phenyl rings, which can influence its solubility and reactivity. The acetic acid functional group (-COOH) contributes to its acidity and potential for forming salts or esters. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The presence of both the methoxy and carboxylic acid groups suggests potential for hydrogen bonding, which can affect its physical properties such as melting point and solubility in various solvents. Additionally, the biphenyl framework may impart unique electronic properties, influencing its behavior in chemical reactions. Overall, 2′-Methoxy[1,1′-biphenyl]-3-acetic acid is a compound of interest in organic chemistry and medicinal chemistry due to its structural features and potential applications.

Formula: C₁₅H₁₄O₃

InChI: InChI=1S/C15H14O3/c1-18-14-8-3-2-7-13(14)12-6-4-5-11(9-12)10-15(16)17/h2-9H,10H2,1H3,(H,16,17)

InChI key: InChIKey=AGFBLMOECRWVDT-UHFFFAOYSA-N

SMILES: O(C)C1=C(C2=CC(CC(O)=O)=CC=C2)C=CC=C1

Synonyms:

• (2'-Methoxybiphenyl-3-yl)acetic acid
• (2′-Methoxy-biphenyl-3-yl)-acetic acid
• 2-[3-(2-Methoxyphenyl)phenyl]acetic acid
• 2′-Methoxy[1,1′-biphenyl]-3-acetic acid
• [1,1'-Biphenyl]-3-acetic acid, 2'-methoxy-

(2′-Methoxy-biphenyl-3-yl)-acetic acid

CAS: 187269-42-7

Formula: C₁₅H₁₄O₃

Purity: 98.0%

Molecular weight: 242.274

Ref: 10-F011451