CAS 187283-17-6

tert-Butyl [4-(bromomethyl)benzyl]carbamate

Description:

Tert-Butyl [4-(bromomethyl)benzyl]carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of an amine with a carbonic acid derivative. This compound features a tert-butyl group, providing steric hindrance and influencing its reactivity and solubility. The presence of the bromomethyl group on the benzyl moiety enhances its electrophilic character, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The compound's structure suggests potential for nucleophilic substitution reactions due to the bromine atom, which can be displaced by nucleophiles. Additionally, the carbamate group can participate in hydrolysis reactions under acidic or basic conditions. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of solvents. Overall, tert-Butyl [4-(bromomethyl)benzyl]carbamate is a versatile intermediate in chemical synthesis, with applications in the development of pharmaceuticals and agrochemicals.

Formula: C₁₃H₁₈BrNO₂

InChI: InChI=1/C13H18BrNO2/c1-13(2,3)17-12(16)15-9-11-6-4-10(8-14)5-7-11/h4-7H,8-9H2,1-3H3,(H,15,16)

SMILES: CC(C)(C)OC(=NCc1ccc(cc1)CBr)O

tert-Butyl 4-(bromomethyl)benzylcarbamate

CAS: 187283-17-6

Formula: C₁₃H₁₈BrNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 300.1915

Ref: IN-DA007S0X

N-BOC-4-(Bromomethyl)benzylamine

CAS: 187283-17-6

N-BOC-4-(Bromomethyl)benzylamine

Formula: C₁₃H₁₈BrNO₂

Purity: 97%

Color and Shape: pale yellow solid

Molecular weight: 300.19g/mol

Ref: 54-OR313092

tert-Butyl 4-(bromomethyl)benzylcarbamate

CAS: 187283-17-6

Formula: C₁₃H₁₈BrNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 300.196

Ref: 10-F077585