CymitQuimica logo

CAS 18729-46-9

:

Cyclopropanemethanol, a-ethyl-

Description:
Cyclopropanemethanol, α-ethyl- (CAS 18729-46-9) is an organic compound characterized by its cyclopropane ring structure with an ethyl group and a hydroxymethyl group attached. This compound features a three-membered cyclopropane ring, which contributes to its unique reactivity and strain. The presence of the hydroxymethyl group indicates that it is an alcohol, which can participate in various chemical reactions, including oxidation and esterification. The ethyl substituent enhances its hydrophobic character, influencing its solubility and interaction with other molecules. Cyclopropanemethanol derivatives are of interest in organic synthesis and medicinal chemistry due to their potential biological activities and applications in the development of pharmaceuticals. Additionally, the strain in the cyclopropane ring can lead to interesting reactivity patterns, making it a valuable building block in synthetic organic chemistry. Overall, this compound exemplifies the interplay between structural features and chemical behavior in organic molecules.
Formula:C6H12O
InChI:InChI=1S/C6H12O/c1-2-6(7)5-3-4-5/h5-7H,2-4H2,1H3
InChI key:ZVTCOQDWIJYYSQ-UHFFFAOYSA-N
SMILES:CCC(C1CC1)O
Found 4 products.