CAS 1873-12-7
:1-Methyl-5-nitro-1H-pyrrole-2-carboxylic acid
Description:
1-Methyl-5-nitro-1H-pyrrole-2-carboxylic acid, with the CAS number 1873-12-7, is a heterocyclic organic compound featuring a pyrrole ring substituted with a methyl group, a nitro group, and a carboxylic acid functional group. This compound typically exhibits a yellow to orange crystalline appearance and is soluble in polar solvents due to the presence of the carboxylic acid group. The nitro group contributes to its potential reactivity, making it a candidate for various chemical transformations. Its structure allows for hydrogen bonding, which can influence its solubility and interaction with other molecules. The compound may be of interest in medicinal chemistry and materials science due to its unique electronic properties and potential biological activity. Additionally, the presence of both electron-withdrawing (nitro) and electron-donating (methyl) groups can affect its acidity and reactivity, making it a valuable subject for further research in organic synthesis and pharmacology.
Formula:C6H6N2O4
InChI:InChI=1S/C6H6N2O4/c1-7-4(6(9)10)2-3-5(7)8(11)12/h2-3H,1H3,(H,9,10)
InChI key:InChIKey=FLRXGGRRZQMJJI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N(C)C(N(=O)=O)=CC1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Methyl-5-nitro-1H-pyrrole-2-carboxylic acid
CAS:Formula:C6H6N2O4Purity:98%Color and Shape:SolidMolecular weight:170.12281-METHYL-5-NITRO-1H-PYRROLE-2-CARBOXYLIC ACID
CAS:Formula:C6H6N2O4Purity:95.0%Molecular weight:170.1241-Methyl-5-nitro-1H-pyrrole-2-carboxylic acid
CAS:1-Methyl-5-nitro-1H-pyrrole-2-carboxylic acid is a synthetic, nonpeptide antiviral agent that inhibits coxsackie virus and other enteroviruses. It is structurally related to the nucleoside analogues of acyclovir and ganciclovir. 1-Methyl-5-nitro-1H-pyrrole-2-carboxylic acid binds to the viral RNA genome in a sequence specific manner. This binding prevents the synthesis of viral proteins, which results in inhibition of virus replication. 1MPA has been shown to inhibit the growth of tumor cell lines in vitro and in vivo, as well as murine leukemia cells transplanted into mice. 1MPA also has an inhibitory effect on the production of tumor necrosis factor (TNF) by murine macrophages activated by tumor cells or lipopolysaccharides.Formula:C6H6N2O4Purity:Min. 95%Molecular weight:170.12 g/mol


